C26H32N4O3 — CID 139010276
N'-[3-(cyclobutanecarbonylamino)propyl]-N-[4-(2,3-dihydroindol-1-ylmethyl)phenyl]-N'-methyloxamide (PubChem CID 139010276) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is N'-[3-(cyclobutanecarbonylamino)propyl]-N-[4-(2,3-dihydroindol-1-ylmethyl)phenyl]-N'-methyloxamide.
| Compound Name | N'-[3-(cyclobutanecarbonylamino)propyl]-N-[4-(2,3-dihydroindol-1-ylmethyl)phenyl]-N'-methyloxamide |
|---|---|
| PubChem CID | 139010276 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | N'-[3-(cyclobutanecarbonylamino)propyl]-N-[4-(2,3-dihydroindol-1-ylmethyl)phenyl]-N'-methyloxamide |
| SMILES | CN(CCCNC(=O)C1CCC1)C(=O)C(=O)Nc1ccc(CN2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C26H32N4O3/c1-29(16-5-15-27-24(31)21-7-4-8-21)26(33)25(32)28-22-12-10-19(11-13-22)18-30-17-14-20-6-2-3-9-23(20)30/h2-3,6,9-13,21H,4-5,7-8,14-18H2,1H3,(H,27,31)(H,28,32) |
| InChIKey | TUGFOZLDZLTLSX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|