C27H34N2O3 — CID 139012650
[4-benzyl-4-(hydroxymethyl)piperidin-1-yl]-[1-(4-methylbenzoyl)piperidin-3-yl]methanone (PubChem CID 139012650) has the molecular formula C27H34N2O3 and a molecular weight of 434.58 g/mol. Its IUPAC name is [4-benzyl-4-(hydroxymethyl)piperidin-1-yl]-[1-(4-methylbenzoyl)piperidin-3-yl]methanone.
| Compound Name | [4-benzyl-4-(hydroxymethyl)piperidin-1-yl]-[1-(4-methylbenzoyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 139012650 |
| Molecular Formula | C27H34N2O3 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | [4-benzyl-4-(hydroxymethyl)piperidin-1-yl]-[1-(4-methylbenzoyl)piperidin-3-yl]methanone |
| SMILES | Cc1ccc(C(=O)N2CCCC(C(=O)N3CCC(CO)(Cc4ccccc4)CC3)C2)cc1 |
| InChI | InChI=1S/C27H34N2O3/c1-21-9-11-23(12-10-21)25(31)29-15-5-8-24(19-29)26(32)28-16-13-27(20-30,14-17-28)18-22-6-3-2-4-7-22/h2-4,6-7,9-12,24,30H,5,8,13-20H2,1H3 |
| InChIKey | AOEDRXXLDISRSE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |