C9H10NO6- — CID 139031387
2-[(2S)-2-amino-2-carboxyethyl]-6-hydroxy-5,6-dioxohexa-1,3-dien-1-olate (PubChem CID 139031387) has the molecular formula C9H10NO6- and a molecular weight of 228.18 g/mol. Its IUPAC name is 2-[(2S)-2-amino-2-carboxyethyl]-6-hydroxy-5,6-dioxohexa-1,3-dien-1-olate.
| Compound Name | 2-[(2S)-2-amino-2-carboxyethyl]-6-hydroxy-5,6-dioxohexa-1,3-dien-1-olate |
|---|---|
| PubChem CID | 139031387 |
| Molecular Formula | C9H10NO6- |
| Molecular Weight | 228.18 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 2-[(2S)-2-amino-2-carboxyethyl]-6-hydroxy-5,6-dioxohexa-1,3-dien-1-olate |
| SMILES | N[C@@H](CC(C=CC(=O)C(=O)O)=C[O-])C(=O)O |
| InChI | InChI=1S/C9H11NO6/c10-6(8(13)14)3-5(4-11)1-2-7(12)9(15)16/h1-2,4,6,11H,3,10H2,(H,13,14)(H,15,16)/p-1/t6-/m0/s1 |
| InChIKey | BHPUNZCEYTVDTI-LURJTMIESA-M |
| XLogP | -1.76 |
| TPSA | 140.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.18 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|