C8H11NO8 — CID 173065727
2-aminobutanedioic acid;but-2-enedioic acid (PubChem CID 173065727) has the molecular formula C8H11NO8 and a molecular weight of 249.17 g/mol. Its IUPAC name is 2-aminobutanedioic acid;but-2-enedioic acid.
| Compound Name | 2-aminobutanedioic acid;but-2-enedioic acid |
|---|---|
| PubChem CID | 173065727 |
| Molecular Formula | C8H11NO8 |
| Molecular Weight | 249.17 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 2-aminobutanedioic acid;but-2-enedioic acid |
| SMILES | NC(CC(=O)O)C(=O)O.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C4H7NO4.C4H4O4/c5-2(4(8)9)1-3(6)7;5-3(6)1-2-4(7)8/h2H,1,5H2,(H,6,7)(H,8,9);1-2H,(H,5,6)(H,7,8) |
| InChIKey | WXZFXUXIIJNJSR-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 175.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.17 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|