C10H8Cl3NO3 — CID 139035815
[4-[(2,2-dichloroacetyl)amino]phenyl]methyl carbonochloridate (PubChem CID 139035815) has the molecular formula C10H8Cl3NO3 and a molecular weight of 296.54 g/mol. Its IUPAC name is [4-[(2,2-dichloroacetyl)amino]phenyl]methyl carbonochloridate.
| Compound Name | [4-[(2,2-dichloroacetyl)amino]phenyl]methyl carbonochloridate |
|---|---|
| PubChem CID | 139035815 |
| Molecular Formula | C10H8Cl3NO3 |
| Molecular Weight | 296.54 g/mol |
| Exact Mass | 294.96 |
| IUPAC Name | [4-[(2,2-dichloroacetyl)amino]phenyl]methyl carbonochloridate |
| SMILES | O=C(Cl)OCc1ccc(NC(=O)C(Cl)Cl)cc1 |
| InChI | InChI=1S/C10H8Cl3NO3/c11-8(12)9(15)14-7-3-1-6(2-4-7)5-17-10(13)16/h1-4,8H,5H2,(H,14,15) |
| InChIKey | NLDJZIDDRZWKCJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.54 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|