C28H33NO2 — CID 139038042
[(1S,2S)-1,2-diphenylhexyl] N-phenyl-N-propan-2-ylcarbamate (PubChem CID 139038042) has the molecular formula C28H33NO2 and a molecular weight of 415.58 g/mol. Its IUPAC name is [(1S,2S)-1,2-diphenylhexyl] N-phenyl-N-propan-2-ylcarbamate.
| Compound Name | [(1S,2S)-1,2-diphenylhexyl] N-phenyl-N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 139038042 |
| Molecular Formula | C28H33NO2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | [(1S,2S)-1,2-diphenylhexyl] N-phenyl-N-propan-2-ylcarbamate |
| SMILES | CCCC[C@@H](c1ccccc1)[C@H](OC(=O)N(c1ccccc1)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C28H33NO2/c1-4-5-21-26(23-15-9-6-10-16-23)27(24-17-11-7-12-18-24)31-28(30)29(22(2)3)25-19-13-8-14-20-25/h6-20,22,26-27H,4-5,21H2,1-3H3/t26-,27+/m0/s1 |
| InChIKey | XTZMADVUKPBALE-RRPNLBNLSA-N |
| XLogP | 7.75 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |