C16H19NO2 — CID 139038374
(6S,8R,12S)-8-methyl-9-oxa-2-azatetracyclo[11.4.0.02,6.08,12]heptadeca-1(17),13,15-trien-3-one (PubChem CID 139038374) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is (6S,8R,12S)-8-methyl-9-oxa-2-azatetracyclo[11.4.0.02,6.08,12]heptadeca-1(17),13,15-trien-3-one.
| Compound Name | (6S,8R,12S)-8-methyl-9-oxa-2-azatetracyclo[11.4.0.02,6.08,12]heptadeca-1(17),13,15-trien-3-one |
|---|---|
| PubChem CID | 139038374 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (6S,8R,12S)-8-methyl-9-oxa-2-azatetracyclo[11.4.0.02,6.08,12]heptadeca-1(17),13,15-trien-3-one |
| SMILES | C[C@@]12C[C@@H]3CCC(=O)N3c3ccccc3[C@@H]1CCO2 |
| InChI | InChI=1S/C16H19NO2/c1-16-10-11-6-7-15(18)17(11)14-5-3-2-4-12(14)13(16)8-9-19-16/h2-5,11,13H,6-10H2,1H3/t11-,13-,16+/m0/s1 |
| InChIKey | KMDQFILTIKUXJE-DETPVDSQSA-N |
| XLogP | 2.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |