C23H32N2O5 — CID 139039520
1-O-tert-butyl 5-O-methyl (1S,3aR,7aR)-3-oxo-2-(2-phenylpropan-2-yl)-1,3a,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-1,5-dicarboxylate (PubChem CID 139039520) has the molecular formula C23H32N2O5 and a molecular weight of 416.52 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-methyl (1S,3aR,7aR)-3-oxo-2-(2-phenylpropan-2-yl)-1,3a,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-1,5-dicarboxylate.
| Compound Name | 1-O-tert-butyl 5-O-methyl (1S,3aR,7aR)-3-oxo-2-(2-phenylpropan-2-yl)-1,3a,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-1,5-dicarboxylate |
|---|---|
| PubChem CID | 139039520 |
| Molecular Formula | C23H32N2O5 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 1-O-tert-butyl 5-O-methyl (1S,3aR,7aR)-3-oxo-2-(2-phenylpropan-2-yl)-1,3a,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-1,5-dicarboxylate |
| SMILES | COC(=O)N1CC[C@@H]2[C@H](C1)C(=O)N(C(C)(C)c1ccccc1)[C@@H]2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H32N2O5/c1-22(2,3)30-20(27)18-16-12-13-24(21(28)29-6)14-17(16)19(26)25(18)23(4,5)15-10-8-7-9-11-15/h7-11,16-18H,12-14H2,1-6H3/t16-,17+,18+/m1/s1 |
| InChIKey | HJOIPOIIGDPBGO-SQNIBIBYSA-N |
| XLogP | 3.18 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |