C32H38N2O8 — CID 139039602
3-(anthracen-9-ylmethylamino)-4-[[(2S)-1,4,7,10,13,16-hexaoxacyclooctadec-2-yl]methylamino]cyclobut-3-ene-1,2-dione (PubChem CID 139039602) has the molecular formula C32H38N2O8 and a molecular weight of 578.66 g/mol. Its IUPAC name is 3-(anthracen-9-ylmethylamino)-4-[[(2S)-1,4,7,10,13,16-hexaoxacyclooctadec-2-yl]methylamino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(anthracen-9-ylmethylamino)-4-[[(2S)-1,4,7,10,13,16-hexaoxacyclooctadec-2-yl]methylamino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 139039602 |
| Molecular Formula | C32H38N2O8 |
| Molecular Weight | 578.66 g/mol |
| Exact Mass | 578.26 |
| IUPAC Name | 3-(anthracen-9-ylmethylamino)-4-[[(2S)-1,4,7,10,13,16-hexaoxacyclooctadec-2-yl]methylamino]cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(NCc2c3ccccc3cc3ccccc23)c(NC[C@H]2COCCOCCOCCOCCOCCO2)c1=O |
| InChI | InChI=1S/C32H38N2O8/c35-31-29(33-20-25-22-41-16-15-39-12-11-37-9-10-38-13-14-40-17-18-42-25)30(32(31)36)34-21-28-26-7-3-1-5-23(26)19-24-6-2-4-8-27(24)28/h1-8,19,25,33-34H,9-18,20-22H2/t25-/m0/s1 |
| InChIKey | VKCLPVCMPHHRFP-VWLOTQADSA-N |
| XLogP | 3.09 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.66 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|