C11H19BrO2 — CID 139039682
(1S,2R,4R,7S)-7-(2-bromoethyl)-1,2-dimethylbicyclo[2.2.1]heptane-2,7-diol (PubChem CID 139039682) has the molecular formula C11H19BrO2 and a molecular weight of 263.17 g/mol. Its IUPAC name is (1S,2R,4R,7S)-7-(2-bromoethyl)-1,2-dimethylbicyclo[2.2.1]heptane-2,7-diol.
| Compound Name | (1S,2R,4R,7S)-7-(2-bromoethyl)-1,2-dimethylbicyclo[2.2.1]heptane-2,7-diol |
|---|---|
| PubChem CID | 139039682 |
| Molecular Formula | C11H19BrO2 |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | (1S,2R,4R,7S)-7-(2-bromoethyl)-1,2-dimethylbicyclo[2.2.1]heptane-2,7-diol |
| SMILES | C[C@]12CC[C@H](C[C@@]1(C)O)[C@@]2(O)CCBr |
| InChI | InChI=1S/C11H19BrO2/c1-9-4-3-8(7-10(9,2)13)11(9,14)5-6-12/h8,13-14H,3-7H2,1-2H3/t8-,9+,10-,11+/m1/s1 |
| InChIKey | RUBZPXYTXSKKDY-YTWAJWBKSA-N |
| XLogP | 2.07 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|