C11H18Br2O — CID 125033645
(1R,2S,4R,7R)-1,7-bis(bromomethyl)-2,7-dimethylbicyclo[2.2.1]heptan-2-ol (PubChem CID 125033645) has the molecular formula C11H18Br2O and a molecular weight of 326.07 g/mol. Its IUPAC name is (1R,2S,4R,7R)-1,7-bis(bromomethyl)-2,7-dimethylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1R,2S,4R,7R)-1,7-bis(bromomethyl)-2,7-dimethylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 125033645 |
| Molecular Formula | C11H18Br2O |
| Molecular Weight | 326.07 g/mol |
| Exact Mass | 323.97 |
| IUPAC Name | (1R,2S,4R,7R)-1,7-bis(bromomethyl)-2,7-dimethylbicyclo[2.2.1]heptan-2-ol |
| SMILES | C[C@]1(O)C[C@H]2CC[C@@]1(CBr)[C@]2(C)CBr |
| InChI | InChI=1S/C11H18Br2O/c1-9(6-12)8-3-4-11(9,7-13)10(2,14)5-8/h8,14H,3-7H2,1-2H3/t8-,9-,10+,11-/m1/s1 |
| InChIKey | CUZDZUKDCNAKGY-CHWFTXMASA-N |
| XLogP | 3.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.07 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|