C11H22BBrO4 — CID 66848286
bromomethylboronic acid;2,6,6-trimethylbicyclo[3.1.1]heptane-1,2-diol (PubChem CID 66848286) has the molecular formula C11H22BBrO4 and a molecular weight of 309.01 g/mol. Its IUPAC name is bromomethylboronic acid;2,6,6-trimethylbicyclo[3.1.1]heptane-1,2-diol.
| Compound Name | bromomethylboronic acid;2,6,6-trimethylbicyclo[3.1.1]heptane-1,2-diol |
|---|---|
| PubChem CID | 66848286 |
| Molecular Formula | C11H22BBrO4 |
| Molecular Weight | 309.01 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | bromomethylboronic acid;2,6,6-trimethylbicyclo[3.1.1]heptane-1,2-diol |
| SMILES | CC1(O)CCC2CC1(O)C2(C)C.OB(O)CBr |
| InChI | InChI=1S/C10H18O2.CH4BBrO2/c1-8(2)7-4-5-9(3,11)10(8,12)6-7;3-1-2(4)5/h7,11-12H,4-6H2,1-3H3;4-5H,1H2 |
| InChIKey | VBNCMQQUVGCZQB-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.01 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|