C16H31BO4 — CID 131720874
3-methylidenepentan-2-ylboronic acid;(1S)-2,6,6-trimethylbicyclo[3.1.1]heptane-1,2-diol (PubChem CID 131720874) has the molecular formula C16H31BO4 and a molecular weight of 298.23 g/mol. Its IUPAC name is 3-methylidenepentan-2-ylboronic acid;(1S)-2,6,6-trimethylbicyclo[3.1.1]heptane-1,2-diol.
| Compound Name | 3-methylidenepentan-2-ylboronic acid;(1S)-2,6,6-trimethylbicyclo[3.1.1]heptane-1,2-diol |
|---|---|
| PubChem CID | 131720874 |
| Molecular Formula | C16H31BO4 |
| Molecular Weight | 298.23 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | 3-methylidenepentan-2-ylboronic acid;(1S)-2,6,6-trimethylbicyclo[3.1.1]heptane-1,2-diol |
| SMILES | C=C(CC)C(C)B(O)O.CC1(O)CCC2C[C@]1(O)C2(C)C |
| InChI | InChI=1S/C10H18O2.C6H13BO2/c1-8(2)7-4-5-9(3,11)10(8,12)6-7;1-4-5(2)6(3)7(8)9/h7,11-12H,4-6H2,1-3H3;6,8-9H,2,4H2,1,3H3/t7?,9?,10-;/m0./s1 |
| InChIKey | DBLBCCUFDIRFAS-UZTBBJOZSA-N |
| XLogP | 2.12 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.23 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|