C18H21Cl — CID 139040140
(4E,5S)-4-[chloro-(4-methylphenyl)methylidene]spiro[4.5]dec-9-ene (PubChem CID 139040140) has the molecular formula C18H21Cl and a molecular weight of 272.82 g/mol. Its IUPAC name is (4E,5S)-4-[chloro-(4-methylphenyl)methylidene]spiro[4.5]dec-9-ene.
| Compound Name | (4E,5S)-4-[chloro-(4-methylphenyl)methylidene]spiro[4.5]dec-9-ene |
|---|---|
| PubChem CID | 139040140 |
| Molecular Formula | C18H21Cl |
| Molecular Weight | 272.82 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (4E,5S)-4-[chloro-(4-methylphenyl)methylidene]spiro[4.5]dec-9-ene |
| SMILES | Cc1ccc(/C(Cl)=C2/CCC[C@@]23C=CCCC3)cc1 |
| InChI | InChI=1S/C18H21Cl/c1-14-7-9-15(10-8-14)17(19)16-6-5-13-18(16)11-3-2-4-12-18/h3,7-11H,2,4-6,12-13H2,1H3/b17-16+/t18-/m0/s1 |
| InChIKey | UXQVLPBVPQIGEG-GVJQPLCZSA-N |
| XLogP | 5.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.82 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|