C22H17BBr2F3NS3 — CID 139040143
7,7-dibromo-4,5-bis(2,5-dimethylthiophen-3-yl)-10-(trifluoromethyl)-3-thia-8-azonia-7-boranuidatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene (PubChem CID 139040143) has the molecular formula C22H17BBr2F3NS3 and a molecular weight of 619.20 g/mol. Its IUPAC name is 7,7-dibromo-4,5-bis(2,5-dimethylthiophen-3-yl)-10-(trifluoromethyl)-3-thia-8-azonia-7-boranuidatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene.
| Compound Name | 7,7-dibromo-4,5-bis(2,5-dimethylthiophen-3-yl)-10-(trifluoromethyl)-3-thia-8-azonia-7-boranuidatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene |
|---|---|
| PubChem CID | 139040143 |
| Molecular Formula | C22H17BBr2F3NS3 |
| Molecular Weight | 619.20 g/mol |
| Exact Mass | 616.89 |
| IUPAC Name | 7,7-dibromo-4,5-bis(2,5-dimethylthiophen-3-yl)-10-(trifluoromethyl)-3-thia-8-azonia-7-boranuidatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene |
| SMILES | Cc1cc(-c2sc3c(c2-c2cc(C)sc2C)[B-](Br)(Br)[n+]2cc(C(F)(F)F)ccc2-3)c(C)s1 |
| InChI | InChI=1S/C22H17BBr2F3NS3/c1-10-7-15(12(3)30-10)18-19-21(32-20(18)16-8-11(2)31-13(16)4)17-6-5-14(22(26,27)28)9-29(17)23(19,24)25/h5-9H,1-4H3 |
| InChIKey | SORINKWCZXBSHO-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.20 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|