C24H24N2O6 — CID 139040686
ethyl (3S)-3-[(3S)-3-ethoxycarbonyl-1-methyl-2-oxoindol-3-yl]-1-methyl-2-oxoindole-3-carboxylate (PubChem CID 139040686) has the molecular formula C24H24N2O6 and a molecular weight of 436.46 g/mol. Its IUPAC name is ethyl (3S)-3-[(3S)-3-ethoxycarbonyl-1-methyl-2-oxoindol-3-yl]-1-methyl-2-oxoindole-3-carboxylate.
| Compound Name | ethyl (3S)-3-[(3S)-3-ethoxycarbonyl-1-methyl-2-oxoindol-3-yl]-1-methyl-2-oxoindole-3-carboxylate |
|---|---|
| PubChem CID | 139040686 |
| Molecular Formula | C24H24N2O6 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | ethyl (3S)-3-[(3S)-3-ethoxycarbonyl-1-methyl-2-oxoindol-3-yl]-1-methyl-2-oxoindole-3-carboxylate |
| SMILES | CCOC(=O)[C@@]1([C@]2(C(=O)OCC)C(=O)N(C)c3ccccc32)C(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C24H24N2O6/c1-5-31-21(29)23(15-11-7-9-13-17(15)25(3)19(23)27)24(22(30)32-6-2)16-12-8-10-14-18(16)26(4)20(24)28/h7-14H,5-6H2,1-4H3/t23-,24-/m0/s1 |
| InChIKey | VONGVWRIKKDWJB-ZEQRLZLVSA-N |
| XLogP | 1.94 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|