C11H16F2N3O4+ — CID 139044316
6-amino-3-[(2S,4R,5S)-3,3-difluoro-4,5-bis(hydroxymethyl)-4-methyloxolan-2-yl]-1H-pyrimidin-3-ium-2-one (PubChem CID 139044316) has the molecular formula C11H16F2N3O4+ and a molecular weight of 292.26 g/mol. Its IUPAC name is 6-amino-3-[(2S,4R,5S)-3,3-difluoro-4,5-bis(hydroxymethyl)-4-methyloxolan-2-yl]-1H-pyrimidin-3-ium-2-one.
| Compound Name | 6-amino-3-[(2S,4R,5S)-3,3-difluoro-4,5-bis(hydroxymethyl)-4-methyloxolan-2-yl]-1H-pyrimidin-3-ium-2-one |
|---|---|
| PubChem CID | 139044316 |
| Molecular Formula | C11H16F2N3O4+ |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 6-amino-3-[(2S,4R,5S)-3,3-difluoro-4,5-bis(hydroxymethyl)-4-methyloxolan-2-yl]-1H-pyrimidin-3-ium-2-one |
| SMILES | C[C@@]1(CO)[C@@H](CO)O[C@H]([n+]2ccc(N)[nH]c2=O)C1(F)F |
| InChI | InChI=1S/C11H15F2N3O4/c1-10(5-18)6(4-17)20-8(11(10,12)13)16-3-2-7(14)15-9(16)19/h2-3,6,8,17-18H,4-5H2,1H3,(H2,14,15,19)/p+1/t6-,8+,10-/m1/s1 |
| InChIKey | NYUCHPAEOWZQRD-KDILMLJESA-O |
| XLogP | -1.23 |
| TPSA | 112.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|