About zinc bis(ditert-butyl-propan-2-ylimino-selenido-λ5-phosphane)
zinc bis(ditert-butyl-propan-2-ylimino-selenido-λ5-phosphane) (PubChem CID 139044867) has the molecular formula C22H50N2P2Se2Zn
and a molecular weight of 627.91 g/mol. Its IUPAC name is zinc bis(ditert-butyl-propan-2-ylimino-selenido-λ5-phosphane).
Molecular Properties
| Compound Name | zinc bis(ditert-butyl-propan-2-ylimino-selenido-λ5-phosphane) |
| PubChem CID | 139044867 |
| Molecular Formula | C22H50N2P2Se2Zn |
| Molecular Weight | 627.91 g/mol |
| Exact Mass | 628.11 |
| IUPAC Name | zinc bis(ditert-butyl-propan-2-ylimino-selenido-λ5-phosphane) |
| SMILES | CC(C)N=P([Se-])(C(C)(C)C)C(C)(C)C.CC(C)N=P([Se-])(C(C)(C)C)C(C)(C)C.[Zn+2] |
| InChI | InChI=1S/2C11H25NPSe.Zn/c2*1-9(2)12-13(14,10(3,4)5)11(6,7)8;/h2*9H,1-8H3;/q2*-1;+2 |
| InChIKey | JEBKTDHCCFOSOB-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 627.91 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze zinc bis(ditert-butyl-propan-2-ylimino-selenido-λ5-phosphane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc bis(ditert-butyl-propan-2-ylimino-selenido-λ5-phosphane)?
The IUPAC name of zinc bis(ditert-butyl-propan-2-ylimino-selenido-λ5-phosphane) (CID 139044867) is zinc bis(ditert-butyl-propan-2-ylimino-selenido-λ5-phosphane).
What is the SMILES notation for zinc bis(ditert-butyl-propan-2-ylimino-selenido-λ5-phosphane)?
The canonical SMILES for zinc bis(ditert-butyl-propan-2-ylimino-selenido-λ5-phosphane) is CC(C)N=P([Se-])(C(C)(C)C)C(C)(C)C.CC(C)N=P([Se-])(C(C)(C)C)C(C)(C)C.[Zn+2].
What is the InChIKey of zinc bis(ditert-butyl-propan-2-ylimino-selenido-λ5-phosphane)?
The InChIKey is JEBKTDHCCFOSOB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H25NPSe.Zn/c2*1-9(2)12-13(14,10(3,4)5)11(6,7)8;/h2*9H,1-8H3;/q2*-1;+2.
What are the key properties of zinc bis(ditert-butyl-propan-2-ylimino-selenido-λ5-phosphane)?
zinc bis(ditert-butyl-propan-2-ylimino-selenido-λ5-phosphane) has a molecular weight of 627.91 g/mol, XLogP of 8.55, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for zinc bis(ditert-butyl-propan-2-ylimino-selenido-λ5-phosphane) is sourced from PubChem (CID 139044867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).