C24H21BF2N2 — CID 139048190
2,2-difluoro-4-phenyl-8-(2,4,6-trimethylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 139048190) has the molecular formula C24H21BF2N2 and a molecular weight of 386.25 g/mol. Its IUPAC name is 2,2-difluoro-4-phenyl-8-(2,4,6-trimethylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-4-phenyl-8-(2,4,6-trimethylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 139048190 |
| Molecular Formula | C24H21BF2N2 |
| Molecular Weight | 386.25 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 2,2-difluoro-4-phenyl-8-(2,4,6-trimethylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | Cc1cc(C)c(C2=C3C=CC=[N+]3[B-](F)(F)n3c2ccc3-c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C24H21BF2N2/c1-16-14-17(2)23(18(3)15-16)24-21-10-7-13-28(21)25(26,27)29-20(11-12-22(24)29)19-8-5-4-6-9-19/h4-15H,1-3H3 |
| InChIKey | SZUBBOUUXJMORI-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.25 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|