C19H24O5 — CID 139048998
(1S,2S,4S,7R,10R,11S,13R,16R)-11-hydroxy-11-methyl-4-prop-1-en-2-yl-14-oxatetracyclo[8.5.1.02,7.013,16]hexadecane-6,9,15-trione (PubChem CID 139048998) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is (1S,2S,4S,7R,10R,11S,13R,16R)-11-hydroxy-11-methyl-4-prop-1-en-2-yl-14-oxatetracyclo[8.5.1.02,7.013,16]hexadecane-6,9,15-trione.
| Compound Name | (1S,2S,4S,7R,10R,11S,13R,16R)-11-hydroxy-11-methyl-4-prop-1-en-2-yl-14-oxatetracyclo[8.5.1.02,7.013,16]hexadecane-6,9,15-trione |
|---|---|
| PubChem CID | 139048998 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (1S,2S,4S,7R,10R,11S,13R,16R)-11-hydroxy-11-methyl-4-prop-1-en-2-yl-14-oxatetracyclo[8.5.1.02,7.013,16]hexadecane-6,9,15-trione |
| SMILES | C=C(C)[C@@H]1CC(=O)[C@@H]2CC(=O)[C@@H]3[C@@H]4[C@@H](C(=O)O[C@@H]4C[C@]3(C)O)[C@H]2C1 |
| InChI | InChI=1S/C19H24O5/c1-8(2)9-4-11-10(12(20)5-9)6-13(21)17-16-14(7-19(17,3)23)24-18(22)15(11)16/h9-11,14-17,23H,1,4-7H2,2-3H3/t9-,10+,11-,14+,15-,16-,17+,19-/m0/s1 |
| InChIKey | JVOXKGJKENCTMI-QICOYSKNSA-N |
| XLogP | 1.68 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|