C44H24F8S4 — CID 139049402
2-[4-[(E)-2-(2,5-difluoro-4-thiophen-2-ylphenyl)ethenyl]-2,5-difluorophenyl]thiophene (PubChem CID 139049402) has the molecular formula C44H24F8S4 and a molecular weight of 832.93 g/mol. Its IUPAC name is 2-[4-[(E)-2-(2,5-difluoro-4-thiophen-2-ylphenyl)ethenyl]-2,5-difluorophenyl]thiophene.
| Compound Name | 2-[4-[(E)-2-(2,5-difluoro-4-thiophen-2-ylphenyl)ethenyl]-2,5-difluorophenyl]thiophene |
|---|---|
| PubChem CID | 139049402 |
| Molecular Formula | C44H24F8S4 |
| Molecular Weight | 832.93 g/mol |
| Exact Mass | 832.06 |
| IUPAC Name | 2-[4-[(E)-2-(2,5-difluoro-4-thiophen-2-ylphenyl)ethenyl]-2,5-difluorophenyl]thiophene |
| SMILES | Fc1cc(-c2cccs2)c(F)cc1/C=C/c1cc(F)c(-c2cccs2)cc1F.Fc1cc(-c2cccs2)c(F)cc1/C=C/c1cc(F)c(-c2cccs2)cc1F |
| InChI | InChI=1S/2C22H12F4S2/c2*23-17-11-15(21-3-1-7-27-21)19(25)9-13(17)5-6-14-10-20(26)16(12-18(14)24)22-4-2-8-28-22/h2*1-12H/b2*6-5+ |
| InChIKey | ONOZGKNVPGNJNU-HBVWGTQWSA-N |
| XLogP | 15.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.93 |
| LogP ≤ 5 | 15.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|