C28H36BNO9 — CID 139054037
azanium;3,6,9,12,15-pentaoxabicyclo[15.3.1]henicosa-1(21),17,19-triene;8,8'-spirobi[7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene] (PubChem CID 139054037) has the molecular formula C28H36BNO9 and a molecular weight of 541.41 g/mol. Its IUPAC name is azanium;3,6,9,12,15-pentaoxabicyclo[15.3.1]henicosa-1(21),17,19-triene;8,8'-spirobi[7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene].
| Compound Name | azanium;3,6,9,12,15-pentaoxabicyclo[15.3.1]henicosa-1(21),17,19-triene;8,8'-spirobi[7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene] |
|---|---|
| PubChem CID | 139054037 |
| Molecular Formula | C28H36BNO9 |
| Molecular Weight | 541.41 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | azanium;3,6,9,12,15-pentaoxabicyclo[15.3.1]henicosa-1(21),17,19-triene;8,8'-spirobi[7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene] |
| SMILES | [NH4+].c1cc2cc(c1)COCCOCCOCCOCCOC2.c1ccc2c(c1)O[B-]1(O2)Oc2ccccc2O1 |
| InChI | InChI=1S/C16H24O5.C12H8BO4.H3N/c1-2-15-12-16(3-1)14-21-11-9-19-7-5-17-4-6-18-8-10-20-13-15;1-2-6-10-9(5-1)14-13(15-10)16-11-7-3-4-8-12(11)17-13;/h1-3,12H,4-11,13-14H2;1-8H;1H3/q;-1;/p+1 |
| InChIKey | PGOAPLXHJNSFHB-UHFFFAOYSA-O |
| XLogP | 4.52 |
| TPSA | 119.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|