C25H31BNO8- — CID 15712013
8-(3,6,9,12,15,18-hexaoxabicyclo[18.3.1]tetracosa-1(24),20,22-trien-24-yl)-7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene-8-carbonitrile (PubChem CID 15712013) has the molecular formula C25H31BNO8- and a molecular weight of 484.33 g/mol. Its IUPAC name is 8-(3,6,9,12,15,18-hexaoxabicyclo[18.3.1]tetracosa-1(24),20,22-trien-24-yl)-7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene-8-carbonitrile.
| Compound Name | 8-(3,6,9,12,15,18-hexaoxabicyclo[18.3.1]tetracosa-1(24),20,22-trien-24-yl)-7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene-8-carbonitrile |
|---|---|
| PubChem CID | 15712013 |
| Molecular Formula | C25H31BNO8- |
| Molecular Weight | 484.33 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 8-(3,6,9,12,15,18-hexaoxabicyclo[18.3.1]tetracosa-1(24),20,22-trien-24-yl)-7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene-8-carbonitrile |
| SMILES | N#C[B-]1(c2c3cccc2COCCOCCOCCOCCOCCOC3)Oc2ccccc2O1 |
| InChI | InChI=1S/C25H31BNO8/c27-20-26(34-23-6-1-2-7-24(23)35-26)25-21-4-3-5-22(25)19-33-17-15-31-13-11-29-9-8-28-10-12-30-14-16-32-18-21/h1-7H,8-19H2/q-1 |
| InChIKey | LGEXKSALDUDLDU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 97.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|