About 2-carboxybenzenesulfonate;dicyclohexylazanium;dihydrate
2-carboxybenzenesulfonate;dicyclohexylazanium;dihydrate (PubChem CID 139054472) has the molecular formula C19H33NO7S
and a molecular weight of 419.54 g/mol. Its IUPAC name is 2-carboxybenzenesulfonate;dicyclohexylazanium;dihydrate.
Molecular Properties
| Compound Name | 2-carboxybenzenesulfonate;dicyclohexylazanium;dihydrate |
| PubChem CID | 139054472 |
| Molecular Formula | C19H33NO7S |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 2-carboxybenzenesulfonate;dicyclohexylazanium;dihydrate |
| SMILES | C1CCC([NH2+]C2CCCCC2)CC1.O.O.O=C(O)c1ccccc1S(=O)(=O)[O-] |
| InChI | InChI=1S/C12H23N.C7H6O5S.2H2O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;8-7(9)5-3-1-2-4-6(5)13(10,11)12;;/h11-13H,1-10H2;1-4H,(H,8,9)(H,10,11,12);2*1H2 |
| InChIKey | UIHQATHIPMPAHM-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 174.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-carboxybenzenesulfonate;dicyclohexylazanium;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carboxybenzenesulfonate;dicyclohexylazanium;dihydrate?
The IUPAC name of 2-carboxybenzenesulfonate;dicyclohexylazanium;dihydrate (CID 139054472) is 2-carboxybenzenesulfonate;dicyclohexylazanium;dihydrate.
What is the SMILES notation for 2-carboxybenzenesulfonate;dicyclohexylazanium;dihydrate?
The canonical SMILES for 2-carboxybenzenesulfonate;dicyclohexylazanium;dihydrate is C1CCC([NH2+]C2CCCCC2)CC1.O.O.O=C(O)c1ccccc1S(=O)(=O)[O-].
What is the InChIKey of 2-carboxybenzenesulfonate;dicyclohexylazanium;dihydrate?
The InChIKey is UIHQATHIPMPAHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N.C7H6O5S.2H2O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;8-7(9)5-3-1-2-4-6(5)13(10,11)12;;/h11-13H,1-10H2;1-4H,(H,8,9)(H,10,11,12);2*1H2.
What are the key properties of 2-carboxybenzenesulfonate;dicyclohexylazanium;dihydrate?
2-carboxybenzenesulfonate;dicyclohexylazanium;dihydrate has a molecular weight of 419.54 g/mol, XLogP of 0.85, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carboxybenzenesulfonate;dicyclohexylazanium;dihydrate is sourced from PubChem (CID 139054472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).