C14H18O9 — CID 139055945
tetramethyl (5R)-4-hydroxycyclohex-3-ene-1,1,3,5-tetracarboxylate (PubChem CID 139055945) has the molecular formula C14H18O9 and a molecular weight of 330.29 g/mol. Its IUPAC name is tetramethyl (5R)-4-hydroxycyclohex-3-ene-1,1,3,5-tetracarboxylate.
| Compound Name | tetramethyl (5R)-4-hydroxycyclohex-3-ene-1,1,3,5-tetracarboxylate |
|---|---|
| PubChem CID | 139055945 |
| Molecular Formula | C14H18O9 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | tetramethyl (5R)-4-hydroxycyclohex-3-ene-1,1,3,5-tetracarboxylate |
| SMILES | COC(=O)C1=C(O)[C@H](C(=O)OC)CC(C(=O)OC)(C(=O)OC)C1 |
| InChI | InChI=1S/C14H18O9/c1-20-10(16)7-5-14(12(18)22-3,13(19)23-4)6-8(9(7)15)11(17)21-2/h7,15H,5-6H2,1-4H3/t7-/m1/s1 |
| InChIKey | HCOMEORDVZCZTG-SSDOTTSWSA-N |
| XLogP | -0.11 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|