C17H20O10 — CID 54687230
tetramethyl 3,8-dihydroxybicyclo[3.3.1]nona-1(8),3-diene-2,4,6,9-tetracarboxylate (PubChem CID 54687230) has the molecular formula C17H20O10 and a molecular weight of 384.34 g/mol. Its IUPAC name is tetramethyl 3,8-dihydroxybicyclo[3.3.1]nona-1(8),3-diene-2,4,6,9-tetracarboxylate.
| Compound Name | tetramethyl 3,8-dihydroxybicyclo[3.3.1]nona-1(8),3-diene-2,4,6,9-tetracarboxylate |
|---|---|
| PubChem CID | 54687230 |
| Molecular Formula | C17H20O10 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | tetramethyl 3,8-dihydroxybicyclo[3.3.1]nona-1(8),3-diene-2,4,6,9-tetracarboxylate |
| SMILES | COC(=O)C1=C(O)C(C(=O)OC)C2=C(O)CC(C(=O)OC)C1C2C(=O)OC |
| InChI | InChI=1S/C17H20O10/c1-24-14(20)6-5-7(18)9-10(15(21)25-2)8(6)11(16(22)26-3)13(19)12(9)17(23)27-4/h6,8,10,12,18-19H,5H2,1-4H3 |
| InChIKey | ZFWDHPSZXYSBSI-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|