C24H17BN2O4 — CID 139056316
1,10-phenanthrolin-10-ium;8,8'-spirobi[7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene] (PubChem CID 139056316) has the molecular formula C24H17BN2O4 and a molecular weight of 408.22 g/mol. Its IUPAC name is 1,10-phenanthrolin-10-ium;8,8'-spirobi[7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene].
| Compound Name | 1,10-phenanthrolin-10-ium;8,8'-spirobi[7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene] |
|---|---|
| PubChem CID | 139056316 |
| Molecular Formula | C24H17BN2O4 |
| Molecular Weight | 408.22 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 1,10-phenanthrolin-10-ium;8,8'-spirobi[7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene] |
| SMILES | c1ccc2c(c1)O[B-]1(O2)Oc2ccccc2O1.c1cnc2c(c1)ccc1ccc[nH+]c12 |
| InChI | InChI=1S/C12H8BO4.C12H8N2/c1-2-6-10-9(5-1)14-13(15-10)16-11-7-3-4-8-12(11)17-13;1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1/h1-8H;1-8H/q-1;/p+1 |
| InChIKey | MJVCQOLZKLVSKW-UHFFFAOYSA-O |
| XLogP | 4.57 |
| TPSA | 63.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.22 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|