C29H19N3O2Zn — CID 139167672
zinc;2-[9-(2-oxidophenyl)-1,10-phenanthrolin-2-yl]phenolate;pyridine (PubChem CID 139167672) has the molecular formula C29H19N3O2Zn and a molecular weight of 506.88 g/mol. Its IUPAC name is zinc;2-[9-(2-oxidophenyl)-1,10-phenanthrolin-2-yl]phenolate;pyridine.
| Compound Name | zinc;2-[9-(2-oxidophenyl)-1,10-phenanthrolin-2-yl]phenolate;pyridine |
|---|---|
| PubChem CID | 139167672 |
| Molecular Formula | C29H19N3O2Zn |
| Molecular Weight | 506.88 g/mol |
| Exact Mass | 505.08 |
| IUPAC Name | zinc;2-[9-(2-oxidophenyl)-1,10-phenanthrolin-2-yl]phenolate;pyridine |
| SMILES | [O-]c1ccccc1-c1ccc2ccc3ccc(-c4ccccc4[O-])nc3c2n1.[Zn+2].c1ccncc1 |
| InChI | InChI=1S/C24H16N2O2.C5H5N.Zn/c27-21-7-3-1-5-17(21)19-13-11-15-9-10-16-12-14-20(26-24(16)23(15)25-19)18-6-2-4-8-22(18)28;1-2-4-6-5-3-1;/h1-14,27-28H;1-5H;/q;;+2/p-2 |
| InChIKey | JZWOOSUMWJCQHD-UHFFFAOYSA-L |
| XLogP | 5.34 |
| TPSA | 84.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.88 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|