About hydron;octadecanoate
hydron;octadecanoate (PubChem CID 139057051) has the molecular formula C18H36O2
and a molecular weight of 284.48 g/mol. Its IUPAC name is hydron;octadecanoate.
Molecular Properties
| Compound Name | hydron;octadecanoate |
| PubChem CID | 139057051 |
| Molecular Formula | C18H36O2 |
| Molecular Weight | 284.48 g/mol |
| Exact Mass | 284.27 |
| IUPAC Name | hydron;octadecanoate |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)[O-].[H+] |
| InChI | InChI=1S/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H,19,20) |
| InChIKey | QIQXTHQIDYTFRH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.48 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hydron;octadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;octadecanoate?
The IUPAC name of hydron;octadecanoate (CID 139057051) is hydron;octadecanoate.
What is the SMILES notation for hydron;octadecanoate?
The canonical SMILES for hydron;octadecanoate is CCCCCCCCCCCCCCCCCC(=O)[O-].[H+].
What is the InChIKey of hydron;octadecanoate?
The InChIKey is QIQXTHQIDYTFRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H,19,20).
What are the key properties of hydron;octadecanoate?
hydron;octadecanoate has a molecular weight of 284.48 g/mol, XLogP of 5.11, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;octadecanoate is sourced from PubChem (CID 139057051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).