C25H21N3O2S — CID 139057679
(2S)-3-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-2-(2-hydroxyphenyl)-1,2-dihydroquinazolin-4-one (PubChem CID 139057679) has the molecular formula C25H21N3O2S and a molecular weight of 427.53 g/mol. Its IUPAC name is (2S)-3-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-2-(2-hydroxyphenyl)-1,2-dihydroquinazolin-4-one.
| Compound Name | (2S)-3-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-2-(2-hydroxyphenyl)-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 139057679 |
| Molecular Formula | C25H21N3O2S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | (2S)-3-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-2-(2-hydroxyphenyl)-1,2-dihydroquinazolin-4-one |
| SMILES | Cc1ccc(-c2csc(N3C(=O)c4ccccc4N[C@@H]3c3ccccc3O)n2)cc1C |
| InChI | InChI=1S/C25H21N3O2S/c1-15-11-12-17(13-16(15)2)21-14-31-25(27-21)28-23(19-8-4-6-10-22(19)29)26-20-9-5-3-7-18(20)24(28)30/h3-14,23,26,29H,1-2H3/t23-/m0/s1 |
| InChIKey | SVPCXYLCHVPSSL-QHCPKHFHSA-N |
| XLogP | 5.90 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|