C34H22N4O4S2 — CID 146322577
14-hydroxy-6,13-bis[4-(4-methylphenyl)-1,3-thiazol-2-yl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12-trione (PubChem CID 146322577) has the molecular formula C34H22N4O4S2 and a molecular weight of 614.71 g/mol. Its IUPAC name is 14-hydroxy-6,13-bis[4-(4-methylphenyl)-1,3-thiazol-2-yl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12-trione.
| Compound Name | 14-hydroxy-6,13-bis[4-(4-methylphenyl)-1,3-thiazol-2-yl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12-trione |
|---|---|
| PubChem CID | 146322577 |
| Molecular Formula | C34H22N4O4S2 |
| Molecular Weight | 614.71 g/mol |
| Exact Mass | 614.11 |
| IUPAC Name | 14-hydroxy-6,13-bis[4-(4-methylphenyl)-1,3-thiazol-2-yl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12-trione |
| SMILES | Cc1ccc(-c2csc(N3C(=O)c4ccc5c6c(ccc(c46)C3=O)C(O)N(c3nc(-c4ccc(C)cc4)cs3)C5=O)n2)cc1 |
| InChI | InChI=1S/C34H22N4O4S2/c1-17-3-7-19(8-4-17)25-15-43-33(35-25)37-29(39)21-11-13-23-28-24(14-12-22(27(21)28)30(37)40)32(42)38(31(23)41)34-36-26(16-44-34)20-9-5-18(2)6-10-20/h3-16,29,39H,1-2H3 |
| InChIKey | YARZRIMJSOFZLT-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.71 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|