C36H24EuF9N2O6S3 — CID 139058407
europium(3+);4-methyl-2-(4-methyl-2-pyridinyl)pyridine;tris((Z)-1,1,1-trifluoro-4-oxo-4-thiophen-2-ylbut-2-en-2-olate) (PubChem CID 139058407) has the molecular formula C36H24EuF9N2O6S3 and a molecular weight of 999.74 g/mol. Its IUPAC name is europium(3+);4-methyl-2-(4-methyl-2-pyridinyl)pyridine;tris((Z)-1,1,1-trifluoro-4-oxo-4-thiophen-2-ylbut-2-en-2-olate).
| Compound Name | europium(3+);4-methyl-2-(4-methyl-2-pyridinyl)pyridine;tris((Z)-1,1,1-trifluoro-4-oxo-4-thiophen-2-ylbut-2-en-2-olate) |
|---|---|
| PubChem CID | 139058407 |
| Molecular Formula | C36H24EuF9N2O6S3 |
| Molecular Weight | 999.74 g/mol |
| Exact Mass | 999.99 |
| IUPAC Name | europium(3+);4-methyl-2-(4-methyl-2-pyridinyl)pyridine;tris((Z)-1,1,1-trifluoro-4-oxo-4-thiophen-2-ylbut-2-en-2-olate) |
| SMILES | Cc1ccnc(-c2cc(C)ccn2)c1.O=C(/C=C(\[O-])C(F)(F)F)c1cccs1.O=C(/C=C(\[O-])C(F)(F)F)c1cccs1.O=C(/C=C(\[O-])C(F)(F)F)c1cccs1.[Eu+3] |
| InChI | InChI=1S/C12H12N2.3C8H5F3O2S.Eu/c1-9-3-5-13-11(7-9)12-8-10(2)4-6-14-12;3*9-8(10,11)7(13)4-5(12)6-2-1-3-14-6;/h3-8H,1-2H3;3*1-4,13H;/q;;;;+3/p-3/b;3*7-4-; |
| InChIKey | KHZUYYBSOIUOJY-QSDLRBNBSA-K |
| XLogP | 7.97 |
| TPSA | 146.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 999.74 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|