C41H23EuF9N3O6S3 — CID 139176362
europium(3+);2-pyridin-2-yl-1,10-phenanthroline;tris((Z)-1,1,1-trifluoro-4-oxo-4-thiophen-2-ylbut-2-en-2-olate) (PubChem CID 139176362) has the molecular formula C41H23EuF9N3O6S3 and a molecular weight of 1072.80 g/mol. Its IUPAC name is europium(3+);2-pyridin-2-yl-1,10-phenanthroline;tris((Z)-1,1,1-trifluoro-4-oxo-4-thiophen-2-ylbut-2-en-2-olate).
| Compound Name | europium(3+);2-pyridin-2-yl-1,10-phenanthroline;tris((Z)-1,1,1-trifluoro-4-oxo-4-thiophen-2-ylbut-2-en-2-olate) |
|---|---|
| PubChem CID | 139176362 |
| Molecular Formula | C41H23EuF9N3O6S3 |
| Molecular Weight | 1072.80 g/mol |
| Exact Mass | 1072.98 |
| IUPAC Name | europium(3+);2-pyridin-2-yl-1,10-phenanthroline;tris((Z)-1,1,1-trifluoro-4-oxo-4-thiophen-2-ylbut-2-en-2-olate) |
| SMILES | O=C(/C=C(\[O-])C(F)(F)F)c1cccs1.O=C(/C=C(\[O-])C(F)(F)F)c1cccs1.O=C(/C=C(\[O-])C(F)(F)F)c1cccs1.[Eu+3].c1ccc(-c2ccc3ccc4cccnc4c3n2)nc1 |
| InChI | InChI=1S/C17H11N3.3C8H5F3O2S.Eu/c1-2-10-18-14(5-1)15-9-8-13-7-6-12-4-3-11-19-16(12)17(13)20-15;3*9-8(10,11)7(13)4-5(12)6-2-1-3-14-6;/h1-11H;3*1-4,13H;/q;;;;+3/p-3/b;3*7-4-; |
| InChIKey | KHQMCVLLMUOWIK-QSDLRBNBSA-K |
| XLogP | 9.06 |
| TPSA | 159.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1072.80 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|