C52H40O20 — CID 139059429
(1S,2R,14R,15S)-4,5,24,25-tetramethoxy-7,12,17,22-tetraoxaheptacyclo[13.11.0.02,14.03,11.06,10.018,26.019,23]hexacosa-3(11),4,6(10),8,18(26),19(23),20,24-octaene-13,16-dione (PubChem CID 139059429) has the molecular formula C52H40O20 and a molecular weight of 984.87 g/mol. Its IUPAC name is (1S,2R,14R,15S)-4,5,24,25-tetramethoxy-7,12,17,22-tetraoxaheptacyclo[13.11.0.02,14.03,11.06,10.018,26.019,23]hexacosa-3(11),4,6(10),8,18(26),19(23),20,24-octaene-13,16-dione.
| Compound Name | (1S,2R,14R,15S)-4,5,24,25-tetramethoxy-7,12,17,22-tetraoxaheptacyclo[13.11.0.02,14.03,11.06,10.018,26.019,23]hexacosa-3(11),4,6(10),8,18(26),19(23),20,24-octaene-13,16-dione |
|---|---|
| PubChem CID | 139059429 |
| Molecular Formula | C52H40O20 |
| Molecular Weight | 984.87 g/mol |
| Exact Mass | 984.21 |
| IUPAC Name | (1S,2R,14R,15S)-4,5,24,25-tetramethoxy-7,12,17,22-tetraoxaheptacyclo[13.11.0.02,14.03,11.06,10.018,26.019,23]hexacosa-3(11),4,6(10),8,18(26),19(23),20,24-octaene-13,16-dione |
| SMILES | COc1c2c(c3ccoc3c1OC)OC(=O)[C@@H]1[C@@H]3C(=O)Oc4c(c(OC)c(OC)c5occc45)[C@@H]3[C@H]21.COc1c2c(c3ccoc3c1OC)OC(=O)[C@@H]1[C@@H]3C(=O)Oc4c(c(OC)c(OC)c5occc45)[C@@H]3[C@H]21 |
| InChI | InChI=1S/2C26H20O10/c2*1-29-21-15-11-12-14(13(11)25(27)35-17(15)9-5-7-33-19(9)23(21)31-3)26(28)36-18-10-6-8-34-20(10)24(32-4)22(30-2)16(12)18/h2*5-8,11-14H,1-4H3/t2*11-,12+,13-,14+ |
| InChIKey | AJXFUAUEBGOBPS-MAFVUFNBSA-N |
| XLogP | 8.33 |
| TPSA | 231.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 984.87 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|