C12H14N2O7S — CID 139060249
3-carboxy-4-hydroxybenzenesulfonate;pyridin-1-ium-3-amine;hydrate (PubChem CID 139060249) has the molecular formula C12H14N2O7S and a molecular weight of 330.32 g/mol. Its IUPAC name is 3-carboxy-4-hydroxybenzenesulfonate;pyridin-1-ium-3-amine;hydrate.
| Compound Name | 3-carboxy-4-hydroxybenzenesulfonate;pyridin-1-ium-3-amine;hydrate |
|---|---|
| PubChem CID | 139060249 |
| Molecular Formula | C12H14N2O7S |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 3-carboxy-4-hydroxybenzenesulfonate;pyridin-1-ium-3-amine;hydrate |
| SMILES | Nc1ccc[nH+]c1.O.O=C(O)c1cc(S(=O)(=O)[O-])ccc1O |
| InChI | InChI=1S/C7H6O6S.C5H6N2.H2O/c8-6-2-1-4(14(11,12)13)3-5(6)7(9)10;6-5-2-1-3-7-4-5;/h1-3,8H,(H,9,10)(H,11,12,13);1-4H,6H2;1H2 |
| InChIKey | SCTWZEUURXOQLB-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 186.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|