C15H22O5 — CID 139064977
8a-O-ethyl 2-O-methyl (4aR,8aS)-3-hydroxy-4,4a,5,6,7,8-hexahydro-1H-naphthalene-2,8a-dicarboxylate (PubChem CID 139064977) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is 8a-O-ethyl 2-O-methyl (4aR,8aS)-3-hydroxy-4,4a,5,6,7,8-hexahydro-1H-naphthalene-2,8a-dicarboxylate.
| Compound Name | 8a-O-ethyl 2-O-methyl (4aR,8aS)-3-hydroxy-4,4a,5,6,7,8-hexahydro-1H-naphthalene-2,8a-dicarboxylate |
|---|---|
| PubChem CID | 139064977 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 8a-O-ethyl 2-O-methyl (4aR,8aS)-3-hydroxy-4,4a,5,6,7,8-hexahydro-1H-naphthalene-2,8a-dicarboxylate |
| SMILES | CCOC(=O)[C@]12CCCC[C@@H]1CC(O)=C(C(=O)OC)C2 |
| InChI | InChI=1S/C15H22O5/c1-3-20-14(18)15-7-5-4-6-10(15)8-12(16)11(9-15)13(17)19-2/h10,16H,3-9H2,1-2H3/t10-,15+/m1/s1 |
| InChIKey | SSPQYDVKWRLQHJ-BMIGLBTASA-N |
| XLogP | 2.51 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |