C22H26O7 — CID 162818707
(5S,8R)-8-ethyl-5-(4-hydroxy-5,6-dimethyl-2-oxopyran-3-yl)-6-(hydroxymethyl)-2,3,8-trimethyl-5,6-dihydrochromene-4,7-dione (PubChem CID 162818707) has the molecular formula C22H26O7 and a molecular weight of 402.44 g/mol. Its IUPAC name is (5S,8R)-8-ethyl-5-(4-hydroxy-5,6-dimethyl-2-oxopyran-3-yl)-6-(hydroxymethyl)-2,3,8-trimethyl-5,6-dihydrochromene-4,7-dione.
| Compound Name | (5S,8R)-8-ethyl-5-(4-hydroxy-5,6-dimethyl-2-oxopyran-3-yl)-6-(hydroxymethyl)-2,3,8-trimethyl-5,6-dihydrochromene-4,7-dione |
|---|---|
| PubChem CID | 162818707 |
| Molecular Formula | C22H26O7 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | (5S,8R)-8-ethyl-5-(4-hydroxy-5,6-dimethyl-2-oxopyran-3-yl)-6-(hydroxymethyl)-2,3,8-trimethyl-5,6-dihydrochromene-4,7-dione |
| SMILES | CC[C@@]1(C)C(=O)C(CO)[C@H](c2c(O)c(C)c(C)oc2=O)c2c1oc(C)c(C)c2=O |
| InChI | InChI=1S/C22H26O7/c1-7-22(6)19(26)13(8-23)14(15-17(24)9(2)11(4)28-20(15)22)16-18(25)10(3)12(5)29-21(16)27/h13-14,23,25H,7-8H2,1-6H3/t13?,14-,22-/m0/s1 |
| InChIKey | BENLGGSSMMCRCK-AZQKXBOTSA-N |
| XLogP | 2.52 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |