C17H21NO6S — CID 139066623
[(1S)-2-carboxy-1-(4-methoxyphenyl)ethyl]azanium;4-methylbenzenesulfonate (PubChem CID 139066623) has the molecular formula C17H21NO6S and a molecular weight of 367.42 g/mol. Its IUPAC name is [(1S)-2-carboxy-1-(4-methoxyphenyl)ethyl]azanium;4-methylbenzenesulfonate.
| Compound Name | [(1S)-2-carboxy-1-(4-methoxyphenyl)ethyl]azanium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139066623 |
| Molecular Formula | C17H21NO6S |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | [(1S)-2-carboxy-1-(4-methoxyphenyl)ethyl]azanium;4-methylbenzenesulfonate |
| SMILES | COc1ccc([C@@H]([NH3+])CC(=O)O)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C10H13NO3.C7H8O3S/c1-14-8-4-2-7(3-5-8)9(11)6-10(12)13;1-6-2-4-7(5-3-6)11(8,9)10/h2-5,9H,6,11H2,1H3,(H,12,13);2-5H,1H3,(H,8,9,10)/t9-;/m0./s1 |
| InChIKey | NKTICNJFBXSNOI-FVGYRXGTSA-N |
| XLogP | 1.35 |
| TPSA | 131.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|