C64H68AgN4O4 — CID 139072140
silver;5,10,15,20-tetrakis(4-pentoxyphenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide (PubChem CID 139072140) has the molecular formula C64H68AgN4O4 and a molecular weight of 1065.14 g/mol. Its IUPAC name is silver;5,10,15,20-tetrakis(4-pentoxyphenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide.
| Compound Name | silver;5,10,15,20-tetrakis(4-pentoxyphenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide |
|---|---|
| PubChem CID | 139072140 |
| Molecular Formula | C64H68AgN4O4 |
| Molecular Weight | 1065.14 g/mol |
| Exact Mass | 1063.43 |
| IUPAC Name | silver;5,10,15,20-tetrakis(4-pentoxyphenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide |
| SMILES | CCCCCOc1ccc([C+]2c3ccc([n-]3)[C+](c3ccc(OCCCCC)cc3)c3ccc([n-]3)[C+](c3ccc(OCCCCC)cc3)c3ccc([n-]3)[C+](c3ccc(OCCCCC)cc3)c3ccc2[n-]3)cc1.[Ag] |
| InChI | InChI=1S/C64H68N4O4.Ag/c1-5-9-13-41-69-49-25-17-45(18-26-49)61-53-33-35-55(65-53)62(46-19-27-50(28-20-46)70-42-14-10-6-2)57-37-39-59(67-57)64(48-23-31-52(32-24-48)72-44-16-12-8-4)60-40-38-58(68-60)63(56-36-34-54(61)66-56)47-21-29-51(30-22-47)71-43-15-11-7-3;/h17-40H,5-16,41-44H2,1-4H3; |
| InChIKey | XMNVDRBAZHSLIK-UHFFFAOYSA-N |
| XLogP | 14.18 |
| TPSA | 93.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1065.14 |
| LogP ≤ 5 | 14.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|