C49H36F3FeN4O7S- — CID 139080454
iron;5,10,15,20-tetrakis(4-methoxyphenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;trifluoromethanesulfonate (PubChem CID 139080454) has the molecular formula C49H36F3FeN4O7S- and a molecular weight of 937.75 g/mol. Its IUPAC name is iron;5,10,15,20-tetrakis(4-methoxyphenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;trifluoromethanesulfonate.
| Compound Name | iron;5,10,15,20-tetrakis(4-methoxyphenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139080454 |
| Molecular Formula | C49H36F3FeN4O7S- |
| Molecular Weight | 937.75 g/mol |
| Exact Mass | 937.16 |
| IUPAC Name | iron;5,10,15,20-tetrakis(4-methoxyphenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;trifluoromethanesulfonate |
| SMILES | COc1ccc([C+]2c3ccc([n-]3)[C+](c3ccc(OC)cc3)c3ccc([n-]3)[C+](c3ccc(OC)cc3)c3ccc([n-]3)[C+](c3ccc(OC)cc3)c3ccc2[n-]3)cc1.O=S(=O)([O-])C(F)(F)F.[Fe] |
| InChI | InChI=1S/C48H36N4O4.CHF3O3S.Fe/c1-53-33-13-5-29(6-14-33)45-37-21-23-39(49-37)46(30-7-15-34(54-2)16-8-30)41-25-27-43(51-41)48(32-11-19-36(56-4)20-12-32)44-28-26-42(52-44)47(40-24-22-38(45)50-40)31-9-17-35(55-3)18-10-31;2-1(3,4)8(5,6)7;/h5-28H,1-4H3;(H,5,6,7);/p-1 |
| InChIKey | GMSUXEBWCNKVIL-UHFFFAOYSA-M |
| XLogP | 7.99 |
| TPSA | 150.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 937.75 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|