C50H38Cl4N4O4Zn — CID 139073835
1,1,2,2-tetrachloroethane;5,10,15,20-tetrakis(4-methoxyphenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;zinc (PubChem CID 139073835) has the molecular formula C50H38Cl4N4O4Zn and a molecular weight of 966.08 g/mol. Its IUPAC name is 1,1,2,2-tetrachloroethane;5,10,15,20-tetrakis(4-methoxyphenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;zinc.
| Compound Name | 1,1,2,2-tetrachloroethane;5,10,15,20-tetrakis(4-methoxyphenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;zinc |
|---|---|
| PubChem CID | 139073835 |
| Molecular Formula | C50H38Cl4N4O4Zn |
| Molecular Weight | 966.08 g/mol |
| Exact Mass | 962.09 |
| IUPAC Name | 1,1,2,2-tetrachloroethane;5,10,15,20-tetrakis(4-methoxyphenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;zinc |
| SMILES | COc1ccc([C+]2c3ccc([n-]3)[C+](c3ccc(OC)cc3)c3ccc([n-]3)[C+](c3ccc(OC)cc3)c3ccc([n-]3)[C+](c3ccc(OC)cc3)c3ccc2[n-]3)cc1.ClC(Cl)C(Cl)Cl.[Zn] |
| InChI | InChI=1S/C48H36N4O4.C2H2Cl4.Zn/c1-53-33-13-5-29(6-14-33)45-37-21-23-39(49-37)46(30-7-15-34(54-2)16-8-30)41-25-27-43(51-41)48(32-11-19-36(56-4)20-12-32)44-28-26-42(52-44)47(40-24-22-38(45)50-40)31-9-17-35(55-3)18-10-31;3-1(4)2(5)6;/h5-28H,1-4H3;1-2H; |
| InChIKey | WMAAQPKDNBNULH-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 93.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 966.08 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|