C38H25CuN4O — CID 139126957
copper(1+);(15Z)-10-(4-methoxyphenyl)-5,15-diphenylcorrin-5,10-diylium-21,22,23-triide (PubChem CID 139126957) has the molecular formula C38H25CuN4O and a molecular weight of 617.19 g/mol. Its IUPAC name is copper(1+);(15Z)-10-(4-methoxyphenyl)-5,15-diphenylcorrin-5,10-diylium-21,22,23-triide.
| Compound Name | copper(1+);(15Z)-10-(4-methoxyphenyl)-5,15-diphenylcorrin-5,10-diylium-21,22,23-triide |
|---|---|
| PubChem CID | 139126957 |
| Molecular Formula | C38H25CuN4O |
| Molecular Weight | 617.19 g/mol |
| Exact Mass | 616.13 |
| IUPAC Name | copper(1+);(15Z)-10-(4-methoxyphenyl)-5,15-diphenylcorrin-5,10-diylium-21,22,23-triide |
| SMILES | COc1ccc([C+]2c3ccc([n-]3)/C(c3ccccc3)=C3/C=CC(=N3)c3ccc([n-]3)[C+](c3ccccc3)c3ccc2[n-]3)cc1.[Cu+] |
| InChI | InChI=1S/C38H25N4O.Cu/c1-43-27-14-12-26(13-15-27)38-34-22-20-32(41-34)36(24-8-4-2-5-9-24)30-18-16-28(39-30)29-17-19-31(40-29)37(25-10-6-3-7-11-25)33-21-23-35(38)42-33;/h2-23H,1H3;/q-1;+1/b36-30-; |
| InChIKey | QAIGQBJGWWDGJJ-KTIIWOGHSA-N |
| XLogP | 6.73 |
| TPSA | 63.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.19 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|