About CID 56648804
CID 56648804 (PubChem CID 56648804) has the molecular formula C52H37BF2N2O
and a molecular weight of 754.69 g/mol.
Molecular Properties
| Compound Name | CID 56648804 |
| PubChem CID | 56648804 |
| Molecular Formula | C52H37BF2N2O |
| Molecular Weight | 754.69 g/mol |
| Exact Mass | 754.30 |
| IUPAC Name | — |
| SMILES | COc1ccc([C+]2c3c(-c4ccccc4)c(-c4ccccc4)c(-c4ccccc4)n3[B-](F)(F)n3c(-c4ccccc4)c(-c4ccccc4)c(-c4ccccc4)c32)cc1 |
| InChI | InChI=1S/C52H37BF2N2O/c1-58-43-34-32-40(33-35-43)48-51-46(38-24-12-4-13-25-38)44(36-20-8-2-9-21-36)49(41-28-16-6-17-29-41)56(51)53(54,55)57-50(42-30-18-7-19-31-42)45(37-22-10-3-11-23-37)47(52(48)57)39-26-14-5-15-27-39/h2-35H,1H3 |
| InChIKey | GEYXFJSITIJAKF-UHFFFAOYSA-N |
| XLogP | 13.40 |
| TPSA | 19.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 754.69 |
| LogP ≤ 5 | 13.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 56648804 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 56648804?
The IUPAC name of CID 56648804 (CID 56648804) is not available.
What is the SMILES notation for CID 56648804?
The canonical SMILES for CID 56648804 is COc1ccc([C+]2c3c(-c4ccccc4)c(-c4ccccc4)c(-c4ccccc4)n3[B-](F)(F)n3c(-c4ccccc4)c(-c4ccccc4)c(-c4ccccc4)c32)cc1.
What is the InChIKey of CID 56648804?
The InChIKey is GEYXFJSITIJAKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C52H37BF2N2O/c1-58-43-34-32-40(33-35-43)48-51-46(38-24-12-4-13-25-38)44(36-20-8-2-9-21-36)49(41-28-16-6-17-29-41)56(51)53(54,55)57-50(42-30-18-7-19-31-42)45(37-22-10-3-11-23-37)47(52(48)57)39-26-14-5-15-27-39/h2-35H,1H3.
What are the key properties of CID 56648804?
CID 56648804 has a molecular weight of 754.69 g/mol, XLogP of 13.40, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 56648804 is sourced from PubChem (CID 56648804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).