C52H37BF2N2O — CID 56648804
CID 56648804 (PubChem CID 56648804) has the molecular formula C52H37BF2N2O and a molecular weight of 754.69 g/mol.
| Compound Name | CID 56648804 |
|---|---|
| PubChem CID | 56648804 |
| Molecular Formula | C52H37BF2N2O |
| Molecular Weight | 754.69 g/mol |
| Exact Mass | 754.30 |
| IUPAC Name | — |
| SMILES | COc1ccc([C+]2c3c(-c4ccccc4)c(-c4ccccc4)c(-c4ccccc4)n3[B-](F)(F)n3c(-c4ccccc4)c(-c4ccccc4)c(-c4ccccc4)c32)cc1 |
| InChI | InChI=1S/C52H37BF2N2O/c1-58-43-34-32-40(33-35-43)48-51-46(38-24-12-4-13-25-38)44(36-20-8-2-9-21-36)49(41-28-16-6-17-29-41)56(51)53(54,55)57-50(42-30-18-7-19-31-42)45(37-22-10-3-11-23-37)47(52(48)57)39-26-14-5-15-27-39/h2-35H,1H3 |
| InChIKey | GEYXFJSITIJAKF-UHFFFAOYSA-N |
| XLogP | 13.40 |
| TPSA | 19.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.69 |
| LogP ≤ 5 | 13.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|