C72H84AgN4O4 — CID 139081803
silver;5,10,15,20-tetrakis(4-heptoxyphenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide (PubChem CID 139081803) has the molecular formula C72H84AgN4O4 and a molecular weight of 1177.36 g/mol. Its IUPAC name is silver;5,10,15,20-tetrakis(4-heptoxyphenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide.
| Compound Name | silver;5,10,15,20-tetrakis(4-heptoxyphenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide |
|---|---|
| PubChem CID | 139081803 |
| Molecular Formula | C72H84AgN4O4 |
| Molecular Weight | 1177.36 g/mol |
| Exact Mass | 1175.55 |
| IUPAC Name | silver;5,10,15,20-tetrakis(4-heptoxyphenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide |
| SMILES | CCCCCCCOc1ccc([C+]2c3ccc([n-]3)[C+](c3ccc(OCCCCCCC)cc3)c3ccc([n-]3)[C+](c3ccc(OCCCCCCC)cc3)c3ccc([n-]3)[C+](c3ccc(OCCCCCCC)cc3)c3ccc2[n-]3)cc1.[Ag] |
| InChI | InChI=1S/C72H84N4O4.Ag/c1-5-9-13-17-21-49-77-57-33-25-53(26-34-57)69-61-41-43-63(73-61)70(54-27-35-58(36-28-54)78-50-22-18-14-10-6-2)65-45-47-67(75-65)72(56-31-39-60(40-32-56)80-52-24-20-16-12-8-4)68-48-46-66(76-68)71(64-44-42-62(69)74-64)55-29-37-59(38-30-55)79-51-23-19-15-11-7-3;/h25-48H,5-24,49-52H2,1-4H3; |
| InChIKey | ZXJBPBCDYBIVFG-UHFFFAOYSA-N |
| XLogP | 17.30 |
| TPSA | 93.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1177.36 |
| LogP ≤ 5 | 17.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|