C56H52N4O12Zn — CID 139144653
5,10,15,20-tetrakis(3,4,5-trimethoxyphenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;zinc (PubChem CID 139144653) has the molecular formula C56H52N4O12Zn and a molecular weight of 1038.44 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(3,4,5-trimethoxyphenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;zinc.
| Compound Name | 5,10,15,20-tetrakis(3,4,5-trimethoxyphenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;zinc |
|---|---|
| PubChem CID | 139144653 |
| Molecular Formula | C56H52N4O12Zn |
| Molecular Weight | 1038.44 g/mol |
| Exact Mass | 1036.29 |
| IUPAC Name | 5,10,15,20-tetrakis(3,4,5-trimethoxyphenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;zinc |
| SMILES | COc1cc([C+]2c3ccc([n-]3)[C+](c3cc(OC)c(OC)c(OC)c3)c3ccc([n-]3)[C+](c3cc(OC)c(OC)c(OC)c3)c3ccc([n-]3)[C+](c3cc(OC)c(OC)c(OC)c3)c3ccc2[n-]3)cc(OC)c1OC.[Zn] |
| InChI | InChI=1S/C56H52N4O12.Zn/c1-61-41-21-29(22-42(62-2)53(41)69-9)49-33-13-15-35(57-33)50(30-23-43(63-3)54(70-10)44(24-30)64-4)37-17-19-39(59-37)52(32-27-47(67-7)56(72-12)48(28-32)68-8)40-20-18-38(60-40)51(36-16-14-34(49)58-36)31-25-45(65-5)55(71-11)46(26-31)66-6;/h13-28H,1-12H3; |
| InChIKey | URJFXOZWJNUNPM-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 167.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 73 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1038.44 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|