C54H62N6O6 — CID 127029628
9-butyl-3-[[4-[[9-butyl-1-(3,4,5-trimethoxyphenyl)pyrido[3,4-b]indol-3-yl]methyl]piperazin-1-yl]methyl]-1-(3,4,5-trimethoxyphenyl)pyrido[3,4-b]indole (PubChem CID 127029628) has the molecular formula C54H62N6O6 and a molecular weight of 891.13 g/mol. Its IUPAC name is 9-butyl-3-[[4-[[9-butyl-1-(3,4,5-trimethoxyphenyl)pyrido[3,4-b]indol-3-yl]methyl]piperazin-1-yl]methyl]-1-(3,4,5-trimethoxyphenyl)pyrido[3,4-b]indole.
| Compound Name | 9-butyl-3-[[4-[[9-butyl-1-(3,4,5-trimethoxyphenyl)pyrido[3,4-b]indol-3-yl]methyl]piperazin-1-yl]methyl]-1-(3,4,5-trimethoxyphenyl)pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 127029628 |
| Molecular Formula | C54H62N6O6 |
| Molecular Weight | 891.13 g/mol |
| Exact Mass | 890.47 |
| IUPAC Name | 9-butyl-3-[[4-[[9-butyl-1-(3,4,5-trimethoxyphenyl)pyrido[3,4-b]indol-3-yl]methyl]piperazin-1-yl]methyl]-1-(3,4,5-trimethoxyphenyl)pyrido[3,4-b]indole |
| SMILES | CCCCn1c2ccccc2c2cc(CN3CCN(Cc4cc5c6ccccc6n(CCCC)c5c(-c5cc(OC)c(OC)c(OC)c5)n4)CC3)nc(-c3cc(OC)c(OC)c(OC)c3)c21 |
| InChI | InChI=1S/C54H62N6O6/c1-9-11-21-59-43-19-15-13-17-39(43)41-31-37(55-49(51(41)59)35-27-45(61-3)53(65-7)46(28-35)62-4)33-57-23-25-58(26-24-57)34-38-32-42-40-18-14-16-20-44(40)60(22-12-10-2)52(42)50(56-38)36-29-47(63-5)54(66-8)48(30-36)64-6/h13-20,27-32H,9-12,21-26,33-34H2,1-8H3 |
| InChIKey | SBUNNOWGKGZUEV-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 97.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.13 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |