About quinolin-2-ylmethyl N-[(E)-1-(3-methylphenyl)ethylideneamino]carbamodithioate
quinolin-2-ylmethyl N-[(E)-1-(3-methylphenyl)ethylideneamino]carbamodithioate (PubChem CID 139072296) has the molecular formula C20H19N3S2
and a molecular weight of 365.53 g/mol. Its IUPAC name is quinolin-2-ylmethyl N-[(E)-1-(3-methylphenyl)ethylideneamino]carbamodithioate.
Molecular Properties
| Compound Name | quinolin-2-ylmethyl N-[(E)-1-(3-methylphenyl)ethylideneamino]carbamodithioate |
| PubChem CID | 139072296 |
| Molecular Formula | C20H19N3S2 |
| Molecular Weight | 365.53 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | quinolin-2-ylmethyl N-[(E)-1-(3-methylphenyl)ethylideneamino]carbamodithioate |
| SMILES | C/C(=N\NC(=S)SCc1ccc2ccccc2n1)c1cccc(C)c1 |
| InChI | InChI=1S/C20H19N3S2/c1-14-6-5-8-17(12-14)15(2)22-23-20(24)25-13-18-11-10-16-7-3-4-9-19(16)21-18/h3-12H,13H2,1-2H3,(H,23,24)/b22-15+ |
| InChIKey | SELKUSHTHOHLRH-PXLXIMEGSA-N |
| XLogP | 5.08 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze quinolin-2-ylmethyl N-[(E)-1-(3-methylphenyl)ethylideneamino]carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-2-ylmethyl N-[(E)-1-(3-methylphenyl)ethylideneamino]carbamodithioate?
The IUPAC name of quinolin-2-ylmethyl N-[(E)-1-(3-methylphenyl)ethylideneamino]carbamodithioate (CID 139072296) is quinolin-2-ylmethyl N-[(E)-1-(3-methylphenyl)ethylideneamino]carbamodithioate.
What is the SMILES notation for quinolin-2-ylmethyl N-[(E)-1-(3-methylphenyl)ethylideneamino]carbamodithioate?
The canonical SMILES for quinolin-2-ylmethyl N-[(E)-1-(3-methylphenyl)ethylideneamino]carbamodithioate is C/C(=N\NC(=S)SCc1ccc2ccccc2n1)c1cccc(C)c1.
What is the InChIKey of quinolin-2-ylmethyl N-[(E)-1-(3-methylphenyl)ethylideneamino]carbamodithioate?
The InChIKey is SELKUSHTHOHLRH-PXLXIMEGSA-N. The full InChI is InChI=1S/C20H19N3S2/c1-14-6-5-8-17(12-14)15(2)22-23-20(24)25-13-18-11-10-16-7-3-4-9-19(16)21-18/h3-12H,13H2,1-2H3,(H,23,24)/b22-15+.
What are the key properties of quinolin-2-ylmethyl N-[(E)-1-(3-methylphenyl)ethylideneamino]carbamodithioate?
quinolin-2-ylmethyl N-[(E)-1-(3-methylphenyl)ethylideneamino]carbamodithioate has a molecular weight of 365.53 g/mol, XLogP of 5.08, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-2-ylmethyl N-[(E)-1-(3-methylphenyl)ethylideneamino]carbamodithioate is sourced from PubChem (CID 139072296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).