C26H28N4O4S2 — CID 139072516
4,6-dimethoxy-2-methylsulfanyl-5-phenylpyrimidine (PubChem CID 139072516) has the molecular formula C26H28N4O4S2 and a molecular weight of 524.67 g/mol. Its IUPAC name is 4,6-dimethoxy-2-methylsulfanyl-5-phenylpyrimidine.
| Compound Name | 4,6-dimethoxy-2-methylsulfanyl-5-phenylpyrimidine |
|---|---|
| PubChem CID | 139072516 |
| Molecular Formula | C26H28N4O4S2 |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | 4,6-dimethoxy-2-methylsulfanyl-5-phenylpyrimidine |
| SMILES | COc1nc(SC)nc(OC)c1-c1ccccc1.COc1nc(SC)nc(OC)c1-c1ccccc1 |
| InChI | InChI=1S/2C13H14N2O2S/c2*1-16-11-10(9-7-5-4-6-8-9)12(17-2)15-13(14-11)18-3/h2*4-8H,1-3H3 |
| InChIKey | FHTLENBZSJHACX-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 88.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |