C45H33N3O6 — CID 141245193
3,5,9,11,15,24-hexamethoxy-6,12,23-triphenyl-2,8,14-triazaheptacyclo[14.6.2.04,21.07,20.010,19.013,18.017,22]tetracosa-1(23),2,4,6,8,10,12,14,16(24),17,19,21-dodecaene (PubChem CID 141245193) has the molecular formula C45H33N3O6 and a molecular weight of 711.77 g/mol. Its IUPAC name is 3,5,9,11,15,24-hexamethoxy-6,12,23-triphenyl-2,8,14-triazaheptacyclo[14.6.2.04,21.07,20.010,19.013,18.017,22]tetracosa-1(23),2,4,6,8,10,12,14,16(24),17,19,21-dodecaene.
| Compound Name | 3,5,9,11,15,24-hexamethoxy-6,12,23-triphenyl-2,8,14-triazaheptacyclo[14.6.2.04,21.07,20.010,19.013,18.017,22]tetracosa-1(23),2,4,6,8,10,12,14,16(24),17,19,21-dodecaene |
|---|---|
| PubChem CID | 141245193 |
| Molecular Formula | C45H33N3O6 |
| Molecular Weight | 711.77 g/mol |
| Exact Mass | 711.24 |
| IUPAC Name | 3,5,9,11,15,24-hexamethoxy-6,12,23-triphenyl-2,8,14-triazaheptacyclo[14.6.2.04,21.07,20.010,19.013,18.017,22]tetracosa-1(23),2,4,6,8,10,12,14,16(24),17,19,21-dodecaene |
| SMILES | COc1nc2c(-c3ccccc3)c(OC)c3c(OC)nc4c(-c5ccccc5)c(OC)c5c(OC)nc6c(-c7ccccc7)c(OC)c1c1c6c5c4c3c21 |
| InChI | InChI=1S/C45H33N3O6/c1-49-40-25(22-16-10-7-11-17-22)37-31-28-32-30-33-29(31)35(44(46-37)53-5)42(51-3)27(24-20-14-9-15-21-24)39(33)48-45(54-6)36(30)41(50-2)26(23-18-12-8-13-19-23)38(32)47-43(52-4)34(28)40/h7-21H,1-6H3 |
| InChIKey | YXGLMVXWAOIGLD-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 94.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.77 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|