C20H30O6 — CID 139072714
(1S,3R,4S,4aR,7S,8R,8aR)-4-[(3aS,5S,6aS)-3a,4,5,6a-tetrahydrofuro[2,3-b]furan-5-yl]-8a-(hydroxymethyl)-3,4-dimethylspiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-oxirane]-1,7-diol (PubChem CID 139072714) has the molecular formula C20H30O6 and a molecular weight of 366.45 g/mol. Its IUPAC name is (1S,3R,4S,4aR,7S,8R,8aR)-4-[(3aS,5S,6aS)-3a,4,5,6a-tetrahydrofuro[2,3-b]furan-5-yl]-8a-(hydroxymethyl)-3,4-dimethylspiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-oxirane]-1,7-diol.
| Compound Name | (1S,3R,4S,4aR,7S,8R,8aR)-4-[(3aS,5S,6aS)-3a,4,5,6a-tetrahydrofuro[2,3-b]furan-5-yl]-8a-(hydroxymethyl)-3,4-dimethylspiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-oxirane]-1,7-diol |
|---|---|
| PubChem CID | 139072714 |
| Molecular Formula | C20H30O6 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | (1S,3R,4S,4aR,7S,8R,8aR)-4-[(3aS,5S,6aS)-3a,4,5,6a-tetrahydrofuro[2,3-b]furan-5-yl]-8a-(hydroxymethyl)-3,4-dimethylspiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,2'-oxirane]-1,7-diol |
| SMILES | C[C@@H]1C[C@H](O)[C@]2(CO)[C@H](CC[C@H](O)[C@]23CO3)[C@@]1(C)[C@@H]1C[C@H]2C=CO[C@H]2O1 |
| InChI | InChI=1S/C20H30O6/c1-11-7-15(23)19(9-21)13(3-4-14(22)20(19)10-25-20)18(11,2)16-8-12-5-6-24-17(12)26-16/h5-6,11-17,21-23H,3-4,7-10H2,1-2H3/t11-,12-,13-,14+,15+,16+,17+,18+,19+,20-/m1/s1 |
| InChIKey | TVZCEYUKZQQZJW-JRXFYOEASA-N |
| XLogP | 1.19 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|